C30H26N6O4S2 — CID 170319448
1-formyl-N-[3-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]naphthalene-2-sulfonamide (PubChem CID 170319448) has the molecular formula C30H26N6O4S2 and a molecular weight of 598.71 g/mol. Its IUPAC name is 1-formyl-N-[3-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]naphthalene-2-sulfonamide.
| Compound Name | 1-formyl-N-[3-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 170319448 |
| Molecular Formula | C30H26N6O4S2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 1-formyl-N-[3-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]naphthalene-2-sulfonamide |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCCNS(=O)(=O)c3ccc4ccccc4c3C=O)n2)c1 |
| InChI | InChI=1S/C30H26N6O4S2/c1-40-22-8-4-7-21(18-22)27-28(36-16-17-41-30(36)35-27)25-12-15-32-29(34-25)31-13-5-14-33-42(38,39)26-11-10-20-6-2-3-9-23(20)24(26)19-37/h2-4,6-12,15-19,33H,5,13-14H2,1H3,(H,31,32,34) |
| InChIKey | CJQFOVJSQPGHLZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|