C14H18N2O3 — CID 170319947
3-butan-2-yl-4-(2-hydroxyacetyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 170319947) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-butan-2-yl-4-(2-hydroxyacetyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 3-butan-2-yl-4-(2-hydroxyacetyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 170319947 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-butan-2-yl-4-(2-hydroxyacetyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | CCC(C)C1C(=O)Nc2ccccc2N1C(=O)CO |
| InChI | InChI=1S/C14H18N2O3/c1-3-9(2)13-14(19)15-10-6-4-5-7-11(10)16(13)12(18)8-17/h4-7,9,13,17H,3,8H2,1-2H3,(H,15,19) |
| InChIKey | KUOFFWCCOTWORC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |