About (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate
(5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate (PubChem CID 170320627) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate.
Molecular Properties
| Compound Name | (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate |
| PubChem CID | 170320627 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate |
| SMILES | CCSC(C)C(C)C(C)C(C=O)OC(C)=O |
| InChI | InChI=1S/C12H22O3S/c1-6-16-10(4)8(2)9(3)12(7-13)15-11(5)14/h7-10,12H,6H2,1-5H3 |
| InChIKey | WXPADVYTXNBQAJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate?
The IUPAC name of (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate (CID 170320627) is (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate.
What is the SMILES notation for (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate?
The canonical SMILES for (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate is CCSC(C)C(C)C(C)C(C=O)OC(C)=O.
What is the InChIKey of (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate?
The InChIKey is WXPADVYTXNBQAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3S/c1-6-16-10(4)8(2)9(3)12(7-13)15-11(5)14/h7-10,12H,6H2,1-5H3.
What are the key properties of (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate?
(5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate has a molecular weight of 246.37 g/mol, XLogP of 2.53, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethylsulfanyl-3,4-dimethyl-1-oxohexan-2-yl) acetate is sourced from PubChem (CID 170320627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).