C13H21F3N2O2 — CID 170321358
tert-butyl 4-prop-2-enyl-3-(trifluoromethyl)piperazine-1-carboxylate (PubChem CID 170321358) has the molecular formula C13H21F3N2O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is tert-butyl 4-prop-2-enyl-3-(trifluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-prop-2-enyl-3-(trifluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170321358 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | tert-butyl 4-prop-2-enyl-3-(trifluoromethyl)piperazine-1-carboxylate |
| SMILES | C=CCN1CCN(C(=O)OC(C)(C)C)CC1C(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O2/c1-5-6-17-7-8-18(9-10(17)13(14,15)16)11(19)20-12(2,3)4/h5,10H,1,6-9H2,2-4H3 |
| InChIKey | AQJJEZCQOKRMAB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|