C17H24BrNO3 — CID 170322242
4-[3-(3-bromo-2-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylic acid (PubChem CID 170322242) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is 4-[3-(3-bromo-2-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylic acid.
| Compound Name | 4-[3-(3-bromo-2-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170322242 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[3-(3-bromo-2-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylic acid |
| SMILES | Cc1c(Br)cccc1OCCCC1CCN(C(=O)O)C(C)C1 |
| InChI | InChI=1S/C17H24BrNO3/c1-12-11-14(8-9-19(12)17(20)21)5-4-10-22-16-7-3-6-15(18)13(16)2/h3,6-7,12,14H,4-5,8-11H2,1-2H3,(H,20,21) |
| InChIKey | SIHKOLBFFTZAKM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|