C27H23N3O3 — CID 17032268
N-(4-methoxyphenyl)-2-[2-(naphthalen-1-yloxymethyl)benzimidazol-1-yl]acetamide (PubChem CID 17032268) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[2-(naphthalen-1-yloxymethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[2-(naphthalen-1-yloxymethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 17032268 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[2-(naphthalen-1-yloxymethyl)benzimidazol-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c(COc3cccc4ccccc34)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H23N3O3/c1-32-21-15-13-20(14-16-21)28-27(31)17-30-24-11-5-4-10-23(24)29-26(30)18-33-25-12-6-8-19-7-2-3-9-22(19)25/h2-16H,17-18H2,1H3,(H,28,31) |
| InChIKey | RLICOSSNIZNGEF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |