C60H84F4N12O2 — CID 170323531
2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine (PubChem CID 170323531) has the molecular formula C60H84F4N12O2 and a molecular weight of 1081.41 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 170323531 |
| Molecular Formula | C60H84F4N12O2 |
| Molecular Weight | 1081.41 g/mol |
| Exact Mass | 1080.68 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbut-1-ynyl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CCC(F)(F)CC3)nc2cc1C#CCCN1CCCC1.COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CCC(F)(F)CC3)nc2cc1C#CCCN1CCCC1 |
| InChI | InChI=1S/2C30H42F2N6O/c2*1-22(2)37-16-9-24(10-17-37)33-28-25-21-27(39-3)23(8-4-5-13-36-14-6-7-15-36)20-26(25)34-29(35-28)38-18-11-30(31,32)12-19-38/h2*20-22,24H,5-7,9-19H2,1-3H3,(H,33,34,35) |
| InChIKey | TWMJKKFTVDDYSG-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.41 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|