C19H24N2 — CID 170323687
(3E,5Z)-3-ethenyl-1-N,2-N-bis[(3Z)-penta-1,3-dien-2-yl]hepta-3,5-diene-1,2-diimine (PubChem CID 170323687) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-1-N,2-N-bis[(3Z)-penta-1,3-dien-2-yl]hepta-3,5-diene-1,2-diimine.
| Compound Name | (3E,5Z)-3-ethenyl-1-N,2-N-bis[(3Z)-penta-1,3-dien-2-yl]hepta-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 170323687 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (3E,5Z)-3-ethenyl-1-N,2-N-bis[(3Z)-penta-1,3-dien-2-yl]hepta-3,5-diene-1,2-diimine |
| SMILES | C=CC(=C\C=C/C)/C(/C=N/C(=C)/C=C\C)=N/C(=C)/C=C\C |
| InChI | InChI=1S/C19H24N2/c1-7-11-14-18(10-4)19(21-17(6)13-9-3)15-20-16(5)12-8-2/h7-15H,4-6H2,1-3H3/b11-7-,12-8-,13-9-,18-14+,20-15+,21-19+ |
| InChIKey | BSBHSHAKYWBJIC-ZPBCGUAKSA-N |
| XLogP | 5.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|