C24H48F6N8 — CID 170323712
4,7,13,16-tetramethyl-21,24-bis(trifluoromethyl)-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane (PubChem CID 170323712) has the molecular formula C24H48F6N8 and a molecular weight of 562.69 g/mol. Its IUPAC name is 4,7,13,16-tetramethyl-21,24-bis(trifluoromethyl)-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane.
| Compound Name | 4,7,13,16-tetramethyl-21,24-bis(trifluoromethyl)-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane |
|---|---|
| PubChem CID | 170323712 |
| Molecular Formula | C24H48F6N8 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | 4,7,13,16-tetramethyl-21,24-bis(trifluoromethyl)-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane |
| SMILES | CN1CCN(C)CCN2CCN(C)CCN(C)CCN(CC1)CCN(C(F)(F)F)CCN(C(F)(F)F)CC2 |
| InChI | InChI=1S/C24H48F6N8/c1-31-5-6-32(2)10-15-36-16-12-34(4)8-7-33(3)11-14-35(13-9-31)17-19-37(23(25,26)27)21-22-38(20-18-36)24(28,29)30/h5-22H2,1-4H3 |
| InChIKey | BHRTUZHLKXMUGQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 25.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|