C24H33BrF3N3O5 — CID 170323912
tert-butyl N-[1-[(2S,4R)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 170323912) has the molecular formula C24H33BrF3N3O5 and a molecular weight of 580.44 g/mol. Its IUPAC name is tert-butyl N-[1-[(2S,4R)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2S,4R)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 170323912 |
| Molecular Formula | C24H33BrF3N3O5 |
| Molecular Weight | 580.44 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | tert-butyl N-[1-[(2S,4R)-2-[[1-(4-bromophenyl)-2,2,2-trifluoroethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)N1C[C@H](O)C[C@H]1C(=O)NC(c1ccc(Br)cc1)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C24H33BrF3N3O5/c1-22(2,3)18(30-21(35)36-23(4,5)6)20(34)31-12-15(32)11-16(31)19(33)29-17(24(26,27)28)13-7-9-14(25)10-8-13/h7-10,15-18,32H,11-12H2,1-6H3,(H,29,33)(H,30,35)/t15-,16+,17?,18?/m1/s1 |
| InChIKey | JWWNTROWZARJMM-VEZWFGLTSA-N |
| XLogP | 4.07 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |