About methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate
methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate (PubChem CID 170324070) has the molecular formula C20H25F3N2O4
and a molecular weight of 414.42 g/mol. Its IUPAC name is methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate |
| PubChem CID | 170324070 |
| Molecular Formula | C20H25F3N2O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)CCC(C)(C)NC(=O)CN1C(=O)C(C)(C)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H25F3N2O4/c1-18(2,9-8-16(27)29-5)24-15(26)11-25-14-7-6-12(20(21,22)23)10-13(14)19(3,4)17(25)28/h6-7,10H,8-9,11H2,1-5H3,(H,24,26) |
| InChIKey | RPKAQZZIUDANEH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate?
The IUPAC name of methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate (CID 170324070) is methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate.
What is the SMILES notation for methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate?
The canonical SMILES for methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate is COC(=O)CCC(C)(C)NC(=O)CN1C(=O)C(C)(C)c2cc(C(F)(F)F)ccc21.
What is the InChIKey of methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate?
The InChIKey is RPKAQZZIUDANEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25F3N2O4/c1-18(2,9-8-16(27)29-5)24-15(26)11-25-14-7-6-12(20(21,22)23)10-13(14)19(3,4)17(25)28/h6-7,10H,8-9,11H2,1-5H3,(H,24,26).
What are the key properties of methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate?
methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate has a molecular weight of 414.42 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-[3,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-1-yl]acetyl]amino]-4-methylpentanoate is sourced from PubChem (CID 170324070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).