C18H23BrN2O5 — CID 170324144
methyl 4-[[2-(5-bromo-7-methoxy-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate (PubChem CID 170324144) has the molecular formula C18H23BrN2O5 and a molecular weight of 427.30 g/mol. Its IUPAC name is methyl 4-[[2-(5-bromo-7-methoxy-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-(5-bromo-7-methoxy-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 170324144 |
| Molecular Formula | C18H23BrN2O5 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | methyl 4-[[2-(5-bromo-7-methoxy-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1C(=O)C(C)(C)c2cc(Br)cc(OC)c21 |
| InChI | InChI=1S/C18H23BrN2O5/c1-18(2)12-8-11(19)9-13(25-3)16(12)21(17(18)24)10-14(22)20-7-5-6-15(23)26-4/h8-9H,5-7,10H2,1-4H3,(H,20,22) |
| InChIKey | FJYHITDILJPJGK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|