C26H29N5O3S — CID 170324162
N-[4-[(2R)-1,1-dioxothiolan-2-yl]phenyl]-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-7,8-dihydro-5H-2,6-naphthyridin-3-amine (PubChem CID 170324162) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is N-[4-[(2R)-1,1-dioxothiolan-2-yl]phenyl]-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-7,8-dihydro-5H-2,6-naphthyridin-3-amine.
| Compound Name | N-[4-[(2R)-1,1-dioxothiolan-2-yl]phenyl]-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-7,8-dihydro-5H-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 170324162 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[4-[(2R)-1,1-dioxothiolan-2-yl]phenyl]-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-7,8-dihydro-5H-2,6-naphthyridin-3-amine |
| SMILES | Cc1c(N2CCc3cnc(Nc4ccc([C@H]5CCCS5(=O)=O)cc4)cc3C2)cnc2c1NCCO2 |
| InChI | InChI=1S/C26H29N5O3S/c1-17-22(15-29-26-25(17)27-9-11-34-26)31-10-8-19-14-28-24(13-20(19)16-31)30-21-6-4-18(5-7-21)23-3-2-12-35(23,32)33/h4-7,13-15,23,27H,2-3,8-12,16H2,1H3,(H,28,30)/t23-/m1/s1 |
| InChIKey | MWVBZSICEHHHIL-HSZRJFAPSA-N |
| XLogP | 4.15 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |