C23H25FN6O3S — CID 170324350
N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 170324350) has the molecular formula C23H25FN6O3S and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170324350 |
| Molecular Formula | C23H25FN6O3S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | Cc1c(N2CCc3cnc(Nc4ccc(CS(C)(=O)=O)c(F)c4)nc3C2)cnc2c1NCCO2 |
| InChI | InChI=1S/C23H25FN6O3S/c1-14-20(11-26-22-21(14)25-6-8-33-22)30-7-5-15-10-27-23(29-19(15)12-30)28-17-4-3-16(18(24)9-17)13-34(2,31)32/h3-4,9-11,25H,5-8,12-13H2,1-2H3,(H,27,28,29) |
| InChIKey | ICWUKZGVCWQRNY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |