C27H33N7O2 — CID 170324608
N-[4-(4-methoxypiperidin-1-yl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 170324608) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is N-[4-(4-methoxypiperidin-1-yl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[4-(4-methoxypiperidin-1-yl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170324608 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | N-[4-(4-methoxypiperidin-1-yl)phenyl]-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | COC1CCN(c2ccc(Nc3ncc4c(n3)CN(c3cnc5c(c3C)NCCO5)CC4)cc2)CC1 |
| InChI | InChI=1S/C27H33N7O2/c1-18-24(16-29-26-25(18)28-10-14-36-26)34-11-7-19-15-30-27(32-23(19)17-34)31-20-3-5-21(6-4-20)33-12-8-22(35-2)9-13-33/h3-6,15-16,22,28H,7-14,17H2,1-2H3,(H,30,31,32) |
| InChIKey | YMEFODZSORZQKP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|