C27H30F3N7O2 — CID 170324685
7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[4-(trifluoromethoxy)piperidin-1-yl]phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 170324685) has the molecular formula C27H30F3N7O2 and a molecular weight of 541.58 g/mol. Its IUPAC name is 7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[4-(trifluoromethoxy)piperidin-1-yl]phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | 7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[4-(trifluoromethoxy)piperidin-1-yl]phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170324685 |
| Molecular Formula | C27H30F3N7O2 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)-N-[4-[4-(trifluoromethoxy)piperidin-1-yl]phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | Cc1c(N2CCc3cnc(Nc4ccc(N5CCC(OC(F)(F)F)CC5)cc4)nc3C2)cnc2c1NCCO2 |
| InChI | InChI=1S/C27H30F3N7O2/c1-17-23(15-32-25-24(17)31-9-13-38-25)37-10-6-18-14-33-26(35-22(18)16-37)34-19-2-4-20(5-3-19)36-11-7-21(8-12-36)39-27(28,29)30/h2-5,14-15,21,31H,6-13,16H2,1H3,(H,33,34,35) |
| InChIKey | UIERYTJKUQWJKU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|