C34H39BrN4O3 — CID 170325417
3-[[3-[4-[1-(6-bromo-3-pyridinyl)piperidin-4-yl]piperidin-1-yl]phenyl]-(4-methoxyphenyl)methyl]piperidine-2,6-dione (PubChem CID 170325417) has the molecular formula C34H39BrN4O3 and a molecular weight of 631.62 g/mol. Its IUPAC name is 3-[[3-[4-[1-(6-bromo-3-pyridinyl)piperidin-4-yl]piperidin-1-yl]phenyl]-(4-methoxyphenyl)methyl]piperidine-2,6-dione.
| Compound Name | 3-[[3-[4-[1-(6-bromo-3-pyridinyl)piperidin-4-yl]piperidin-1-yl]phenyl]-(4-methoxyphenyl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170325417 |
| Molecular Formula | C34H39BrN4O3 |
| Molecular Weight | 631.62 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 3-[[3-[4-[1-(6-bromo-3-pyridinyl)piperidin-4-yl]piperidin-1-yl]phenyl]-(4-methoxyphenyl)methyl]piperidine-2,6-dione |
| SMILES | COc1ccc(C(c2cccc(N3CCC(C4CCN(c5ccc(Br)nc5)CC4)CC3)c2)C2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C34H39BrN4O3/c1-42-29-8-5-25(6-9-29)33(30-10-12-32(40)37-34(30)41)26-3-2-4-27(21-26)38-17-13-23(14-18-38)24-15-19-39(20-16-24)28-7-11-31(35)36-22-28/h2-9,11,21-24,30,33H,10,12-20H2,1H3,(H,37,40,41) |
| InChIKey | HVHKVCFXHUYQAI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|