C27H33ClFN6O2S+ — CID 170325891
[4-[[5-[2-[6-[(2-chlorophenyl)sulfonylamino]-5-fluoro-2-methyl-3-pyridinyl]ethyl]pyrimidin-2-yl]amino]cyclohexyl]methylidene-dimethylazanium (PubChem CID 170325891) has the molecular formula C27H33ClFN6O2S+ and a molecular weight of 560.12 g/mol. Its IUPAC name is [4-[[5-[2-[6-[(2-chlorophenyl)sulfonylamino]-5-fluoro-2-methyl-3-pyridinyl]ethyl]pyrimidin-2-yl]amino]cyclohexyl]methylidene-dimethylazanium.
| Compound Name | [4-[[5-[2-[6-[(2-chlorophenyl)sulfonylamino]-5-fluoro-2-methyl-3-pyridinyl]ethyl]pyrimidin-2-yl]amino]cyclohexyl]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 170325891 |
| Molecular Formula | C27H33ClFN6O2S+ |
| Molecular Weight | 560.12 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | [4-[[5-[2-[6-[(2-chlorophenyl)sulfonylamino]-5-fluoro-2-methyl-3-pyridinyl]ethyl]pyrimidin-2-yl]amino]cyclohexyl]methylidene-dimethylazanium |
| SMILES | Cc1nc(NS(=O)(=O)c2ccccc2Cl)c(F)cc1CCc1cnc(NC2CCC(C=[N+](C)C)CC2)nc1 |
| InChI | InChI=1S/C27H33ClFN6O2S/c1-18-21(14-24(29)26(32-18)34-38(36,37)25-7-5-4-6-23(25)28)11-8-20-15-30-27(31-16-20)33-22-12-9-19(10-13-22)17-35(2)3/h4-7,14-17,19,22H,8-13H2,1-3H3,(H,32,34)(H,30,31,33)/q+1 |
| InChIKey | HBRGAVALVVQQBF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.12 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|