About 1-bromo-4-fluorobenzene;1,4-dioxane
1-bromo-4-fluorobenzene;1,4-dioxane (PubChem CID 170328138) has the molecular formula C10H12BrFO2
and a molecular weight of 263.11 g/mol. Its IUPAC name is 1-bromo-4-fluorobenzene;1,4-dioxane.
Molecular Properties
| Compound Name | 1-bromo-4-fluorobenzene;1,4-dioxane |
| PubChem CID | 170328138 |
| Molecular Formula | C10H12BrFO2 |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1-bromo-4-fluorobenzene;1,4-dioxane |
| SMILES | C1COCCO1.Fc1ccc(Br)cc1 |
| InChI | InChI=1S/C6H4BrF.C4H8O2/c7-5-1-3-6(8)4-2-5;1-2-6-4-3-5-1/h1-4H;1-4H2 |
| InChIKey | ZETPVTUECSSODK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-4-fluorobenzene;1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-fluorobenzene;1,4-dioxane?
The IUPAC name of 1-bromo-4-fluorobenzene;1,4-dioxane (CID 170328138) is 1-bromo-4-fluorobenzene;1,4-dioxane.
What is the SMILES notation for 1-bromo-4-fluorobenzene;1,4-dioxane?
The canonical SMILES for 1-bromo-4-fluorobenzene;1,4-dioxane is C1COCCO1.Fc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-fluorobenzene;1,4-dioxane?
The InChIKey is ZETPVTUECSSODK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF.C4H8O2/c7-5-1-3-6(8)4-2-5;1-2-6-4-3-5-1/h1-4H;1-4H2.
What are the key properties of 1-bromo-4-fluorobenzene;1,4-dioxane?
1-bromo-4-fluorobenzene;1,4-dioxane has a molecular weight of 263.11 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-fluorobenzene;1,4-dioxane is sourced from PubChem (CID 170328138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).