About 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione
1-pyridin-2-yl-3,7-dihydropurine-2,6-dione (PubChem CID 170328644) has the molecular formula C10H7N5O2
and a molecular weight of 229.20 g/mol. Its IUPAC name is 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione |
| PubChem CID | 170328644 |
| Molecular Formula | C10H7N5O2 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c2nc[nH]c2c(=O)n1-c1ccccn1 |
| InChI | InChI=1S/C10H7N5O2/c16-9-7-8(13-5-12-7)14-10(17)15(9)6-3-1-2-4-11-6/h1-5H,(H,12,13)(H,14,17) |
| InChIKey | GCWIDJYPNNMSKT-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione?
The IUPAC name of 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione (CID 170328644) is 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione is O=c1[nH]c2nc[nH]c2c(=O)n1-c1ccccn1.
What is the InChIKey of 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione?
The InChIKey is GCWIDJYPNNMSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5O2/c16-9-7-8(13-5-12-7)14-10(17)15(9)6-3-1-2-4-11-6/h1-5H,(H,12,13)(H,14,17).
What are the key properties of 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione?
1-pyridin-2-yl-3,7-dihydropurine-2,6-dione has a molecular weight of 229.20 g/mol, XLogP of -0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-yl-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 170328644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).