C26H37N3O6 — CID 170329377
tert-butyl N-[1-[(2S,4R)-2-[1-(4-ethynyl-2-hydroxyphenyl)ethylcarbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 170329377) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is tert-butyl N-[1-[(2S,4R)-2-[1-(4-ethynyl-2-hydroxyphenyl)ethylcarbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2S,4R)-2-[1-(4-ethynyl-2-hydroxyphenyl)ethylcarbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 170329377 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | tert-butyl N-[1-[(2S,4R)-2-[1-(4-ethynyl-2-hydroxyphenyl)ethylcarbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C26H37N3O6/c1-9-16-10-11-18(20(31)12-16)15(2)27-22(32)19-13-17(30)14-29(19)23(33)21(25(3,4)5)28-24(34)35-26(6,7)8/h1,10-12,15,17,19,21,30-31H,13-14H2,2-8H3,(H,27,32)(H,28,34)/t15?,17-,19+,21?/m1/s1 |
| InChIKey | RKPKYKPUZZSSEF-WQGRSQCMSA-N |
| XLogP | 2.45 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|