C25H29ClFN5OS — CID 170329706
N-[(1Z,3E)-4-[6-[(2-chlorophenyl)sulfanylamino]-5-fluoro-2-methoxy-3-pyridinyl]-2-(methyliminomethyl)buta-1,3-dienyl]-N'-cyclohexylmethanimidamide (PubChem CID 170329706) has the molecular formula C25H29ClFN5OS and a molecular weight of 502.06 g/mol. Its IUPAC name is N-[(1Z,3E)-4-[6-[(2-chlorophenyl)sulfanylamino]-5-fluoro-2-methoxy-3-pyridinyl]-2-(methyliminomethyl)buta-1,3-dienyl]-N'-cyclohexylmethanimidamide.
| Compound Name | N-[(1Z,3E)-4-[6-[(2-chlorophenyl)sulfanylamino]-5-fluoro-2-methoxy-3-pyridinyl]-2-(methyliminomethyl)buta-1,3-dienyl]-N'-cyclohexylmethanimidamide |
|---|---|
| PubChem CID | 170329706 |
| Molecular Formula | C25H29ClFN5OS |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-[(1Z,3E)-4-[6-[(2-chlorophenyl)sulfanylamino]-5-fluoro-2-methoxy-3-pyridinyl]-2-(methyliminomethyl)buta-1,3-dienyl]-N'-cyclohexylmethanimidamide |
| SMILES | C/N=C/C(=C\N/C=N/C1CCCCC1)/C=C/c1cc(F)c(NSc2ccccc2Cl)nc1OC |
| InChI | InChI=1S/C25H29ClFN5OS/c1-28-15-18(16-29-17-30-20-8-4-3-5-9-20)12-13-19-14-22(27)24(31-25(19)33-2)32-34-23-11-7-6-10-21(23)26/h6-7,10-17,20H,3-5,8-9H2,1-2H3,(H,29,30)(H,31,32)/b13-12+,18-16-,28-15+ |
| InChIKey | OAYVHGCLFCZPRW-NEAWGODASA-N |
| XLogP | 6.55 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|