About 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide
4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 170329785) has the molecular formula C12H15F3N2O5S2
and a molecular weight of 388.39 g/mol. Its IUPAC name is 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| PubChem CID | 170329785 |
| Molecular Formula | C12H15F3N2O5S2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N[C@H]2CC[C@H](O)C2)c(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O5S2/c13-12(14,15)23(19,20)11-6-9(24(16,21)22)3-4-10(11)17-7-1-2-8(18)5-7/h3-4,6-8,17-18H,1-2,5H2,(H2,16,21,22)/t7-,8-/m0/s1 |
| InChIKey | APOFDUDNRBGSQI-YUMQZZPRSA-N |
| XLogP | 0.95 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide?
The IUPAC name of 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide (CID 170329785) is 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide.
What is the SMILES notation for 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide?
The canonical SMILES for 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide is NS(=O)(=O)c1ccc(N[C@H]2CC[C@H](O)C2)c(S(=O)(=O)C(F)(F)F)c1.
What is the InChIKey of 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide?
The InChIKey is APOFDUDNRBGSQI-YUMQZZPRSA-N. The full InChI is InChI=1S/C12H15F3N2O5S2/c13-12(14,15)23(19,20)11-6-9(24(16,21)22)3-4-10(11)17-7-1-2-8(18)5-7/h3-4,6-8,17-18H,1-2,5H2,(H2,16,21,22)/t7-,8-/m0/s1.
What are the key properties of 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide?
4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide has a molecular weight of 388.39 g/mol, XLogP of 0.95, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S,3S)-3-hydroxycyclopentyl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide is sourced from PubChem (CID 170329785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).