C23H20ClN3O3 — CID 17032990
N-(4-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide (PubChem CID 17032990) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 17032990 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-(3,4-dimethoxyphenyl)benzimidazol-1-yl]acetamide |
| SMILES | COc1ccc(-c2nc3ccccc3n2CC(=O)Nc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C23H20ClN3O3/c1-29-20-12-7-15(13-21(20)30-2)23-26-18-5-3-4-6-19(18)27(23)14-22(28)25-17-10-8-16(24)9-11-17/h3-13H,14H2,1-2H3,(H,25,28) |
| InChIKey | WZLLOQIZMZFOKH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |