C22H26Cl2FN3O3 — CID 170330311
N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxamide (PubChem CID 170330311) has the molecular formula C22H26Cl2FN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxamide.
| Compound Name | N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 170330311 |
| Molecular Formula | C22H26Cl2FN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxamide |
| SMILES | CN1C(=O)NC2(CCC(C(=O)N[C@H](c3c(F)ccc(Cl)c3Cl)C3(C)CCCC3)C2)C1=O |
| InChI | InChI=1S/C22H26Cl2FN3O3/c1-21(8-3-4-9-21)17(15-14(25)6-5-13(23)16(15)24)26-18(29)12-7-10-22(11-12)19(30)28(2)20(31)27-22/h5-6,12,17H,3-4,7-11H2,1-2H3,(H,26,29)(H,27,31)/t12?,17-,22?/m1/s1 |
| InChIKey | IFNLWRHEKVEIHI-NWMPWSGNSA-N |
| XLogP | 4.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|