C26H31F3N2O3S — CID 170331318
N-[1-[4-[(1,3-dimethyl-2,3-dihydro-1H-inden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide (PubChem CID 170331318) has the molecular formula C26H31F3N2O3S and a molecular weight of 508.61 g/mol. Its IUPAC name is N-[1-[4-[(1,3-dimethyl-2,3-dihydro-1H-inden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-[1-[4-[(1,3-dimethyl-2,3-dihydro-1H-inden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 170331318 |
| Molecular Formula | C26H31F3N2O3S |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | N-[1-[4-[(1,3-dimethyl-2,3-dihydro-1H-inden-2-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide |
| SMILES | CC1c2ccccc2C(C)C1Nc1ccc(C(N(C)C(=O)C2CCS(=O)(=O)CC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H31F3N2O3S/c1-16-21-6-4-5-7-22(21)17(2)23(16)30-20-10-8-18(9-11-20)24(26(27,28)29)31(3)25(32)19-12-14-35(33,34)15-13-19/h4-11,16-17,19,23-24,30H,12-15H2,1-3H3 |
| InChIKey | DFSPOUDGYSFPRL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |