About 4-bromo-5-chloro-1,3-dihydroinden-2-one
4-bromo-5-chloro-1,3-dihydroinden-2-one (PubChem CID 170331387) has the molecular formula C9H6BrClO
and a molecular weight of 245.50 g/mol. Its IUPAC name is 4-bromo-5-chloro-1,3-dihydroinden-2-one.
Molecular Properties
| Compound Name | 4-bromo-5-chloro-1,3-dihydroinden-2-one |
| PubChem CID | 170331387 |
| Molecular Formula | C9H6BrClO |
| Molecular Weight | 245.50 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | 4-bromo-5-chloro-1,3-dihydroinden-2-one |
| SMILES | O=C1Cc2ccc(Cl)c(Br)c2C1 |
| InChI | InChI=1S/C9H6BrClO/c10-9-7-4-6(12)3-5(7)1-2-8(9)11/h1-2H,3-4H2 |
| InChIKey | CQCLUGMLXVKIPQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-5-chloro-1,3-dihydroinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-chloro-1,3-dihydroinden-2-one?
The IUPAC name of 4-bromo-5-chloro-1,3-dihydroinden-2-one (CID 170331387) is 4-bromo-5-chloro-1,3-dihydroinden-2-one.
What is the SMILES notation for 4-bromo-5-chloro-1,3-dihydroinden-2-one?
The canonical SMILES for 4-bromo-5-chloro-1,3-dihydroinden-2-one is O=C1Cc2ccc(Cl)c(Br)c2C1.
What is the InChIKey of 4-bromo-5-chloro-1,3-dihydroinden-2-one?
The InChIKey is CQCLUGMLXVKIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrClO/c10-9-7-4-6(12)3-5(7)1-2-8(9)11/h1-2H,3-4H2.
What are the key properties of 4-bromo-5-chloro-1,3-dihydroinden-2-one?
4-bromo-5-chloro-1,3-dihydroinden-2-one has a molecular weight of 245.50 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-chloro-1,3-dihydroinden-2-one is sourced from PubChem (CID 170331387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).