C23H24Cl2F3N3O3S — CID 170331445
N-[1-[5-[(4,6-dichloro-2,3-dihydro-1H-inden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide (PubChem CID 170331445) has the molecular formula C23H24Cl2F3N3O3S and a molecular weight of 550.43 g/mol. Its IUPAC name is N-[1-[5-[(4,6-dichloro-2,3-dihydro-1H-inden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-[1-[5-[(4,6-dichloro-2,3-dihydro-1H-inden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 170331445 |
| Molecular Formula | C23H24Cl2F3N3O3S |
| Molecular Weight | 550.43 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | N-[1-[5-[(4,6-dichloro-2,3-dihydro-1H-inden-2-yl)amino]-2-pyridinyl]-2,2,2-trifluoroethyl]-N-methyl-1,1-dioxothiane-4-carboxamide |
| SMILES | CN(C(=O)C1CCS(=O)(=O)CC1)C(c1ccc(NC2Cc3cc(Cl)cc(Cl)c3C2)cn1)C(F)(F)F |
| InChI | InChI=1S/C23H24Cl2F3N3O3S/c1-31(22(32)13-4-6-35(33,34)7-5-13)21(23(26,27)28)20-3-2-16(12-29-20)30-17-9-14-8-15(24)10-19(25)18(14)11-17/h2-3,8,10,12-13,17,21,30H,4-7,9,11H2,1H3 |
| InChIKey | WTGRDNJXNMPQES-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |