C19H19Cl2N3O — CID 17033158
N-butyl-2-[2-(2,4-dichlorophenyl)benzimidazol-1-yl]acetamide (PubChem CID 17033158) has the molecular formula C19H19Cl2N3O and a molecular weight of 376.29 g/mol. Its IUPAC name is N-butyl-2-[2-(2,4-dichlorophenyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-butyl-2-[2-(2,4-dichlorophenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 17033158 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-butyl-2-[2-(2,4-dichlorophenyl)benzimidazol-1-yl]acetamide |
| SMILES | CCCCNC(=O)Cn1c(-c2ccc(Cl)cc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C19H19Cl2N3O/c1-2-3-10-22-18(25)12-24-17-7-5-4-6-16(17)23-19(24)14-9-8-13(20)11-15(14)21/h4-9,11H,2-3,10,12H2,1H3,(H,22,25) |
| InChIKey | RQVJFUAQJNGMAP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|