About 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine
8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine (PubChem CID 170331763) has the molecular formula C15H18F2N4
and a molecular weight of 292.33 g/mol. Its IUPAC name is 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine.
Molecular Properties
| Compound Name | 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine |
| PubChem CID | 170331763 |
| Molecular Formula | C15H18F2N4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine |
| SMILES | Cc1cc2cc(N)cc(N3CCC(F)(F)CC3)c2nc1N |
| InChI | InChI=1S/C15H18F2N4/c1-9-6-10-7-11(18)8-12(13(10)20-14(9)19)21-4-2-15(16,17)3-5-21/h6-8H,2-5,18H2,1H3,(H2,19,20) |
| InChIKey | LBPRUCGQKSSSRC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine?
The IUPAC name of 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine (CID 170331763) is 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine.
What is the SMILES notation for 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine?
The canonical SMILES for 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine is Cc1cc2cc(N)cc(N3CCC(F)(F)CC3)c2nc1N.
What is the InChIKey of 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine?
The InChIKey is LBPRUCGQKSSSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N4/c1-9-6-10-7-11(18)8-12(13(10)20-14(9)19)21-4-2-15(16,17)3-5-21/h6-8H,2-5,18H2,1H3,(H2,19,20).
What are the key properties of 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine?
8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine has a molecular weight of 292.33 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4,4-difluoropiperidin-1-yl)-3-methylquinoline-2,6-diamine is sourced from PubChem (CID 170331763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).