About 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate
2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate (PubChem CID 170331864) has the molecular formula C42H84O5S5
and a molecular weight of 829.46 g/mol. Its IUPAC name is 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate |
| PubChem CID | 170331864 |
| Molecular Formula | C42H84O5S5 |
| Molecular Weight | 829.46 g/mol |
| Exact Mass | 828.49 |
| IUPAC Name | 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate |
| SMILES | CCCCCCCCCSCSCCCCCCCCC1(CCCCCCCCSCSCCCCCCCCC)OCC(CCOS(C)(=O)=O)O1 |
| InChI | InChI=1S/C42H84O5S5/c1-4-6-8-10-14-20-26-34-48-39-50-36-28-22-16-12-18-24-31-42(45-38-41(47-42)30-33-46-52(3,43)44)32-25-19-13-17-23-29-37-51-40-49-35-27-21-15-11-9-7-5-2/h41H,4-40H2,1-3H3 |
| InChIKey | BSTBUHCNYHUMHU-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 829.46 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate?
The IUPAC name of 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate (CID 170331864) is 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate.
What is the SMILES notation for 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate?
The canonical SMILES for 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate is CCCCCCCCCSCSCCCCCCCCC1(CCCCCCCCSCSCCCCCCCCC)OCC(CCOS(C)(=O)=O)O1.
What is the InChIKey of 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate?
The InChIKey is BSTBUHCNYHUMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H84O5S5/c1-4-6-8-10-14-20-26-34-48-39-50-36-28-22-16-12-18-24-31-42(45-38-41(47-42)30-33-46-52(3,43)44)32-25-19-13-17-23-29-37-51-40-49-35-27-21-15-11-9-7-5-2/h41H,4-40H2,1-3H3.
What are the key properties of 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate?
2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate has a molecular weight of 829.46 g/mol, XLogP of 14.27, 42 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-bis[8-(nonylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate is sourced from PubChem (CID 170331864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).