About N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide
N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide (PubChem CID 170331880) has the molecular formula C19H23BrFNO4S
and a molecular weight of 460.37 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide |
| PubChem CID | 170331880 |
| Molecular Formula | C19H23BrFNO4S |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide |
| SMILES | COC(CN(Cc1ccc(Br)cc1F)S(=O)(=O)c1ccc(C)cc1C)OC |
| InChI | InChI=1S/C19H23BrFNO4S/c1-13-5-8-18(14(2)9-13)27(23,24)22(12-19(25-3)26-4)11-15-6-7-16(20)10-17(15)21/h5-10,19H,11-12H2,1-4H3 |
| InChIKey | ADCKSWNNQUYXMU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide?
The IUPAC name of N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide (CID 170331880) is N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide.
What is the SMILES notation for N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide?
The canonical SMILES for N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide is COC(CN(Cc1ccc(Br)cc1F)S(=O)(=O)c1ccc(C)cc1C)OC.
What is the InChIKey of N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide?
The InChIKey is ADCKSWNNQUYXMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrFNO4S/c1-13-5-8-18(14(2)9-13)27(23,24)22(12-19(25-3)26-4)11-15-6-7-16(20)10-17(15)21/h5-10,19H,11-12H2,1-4H3.
What are the key properties of N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide?
N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide has a molecular weight of 460.37 g/mol, XLogP of 4.01, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-bromo-2-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dimethylbenzenesulfonamide is sourced from PubChem (CID 170331880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).