C11H12ClN5O2 — CID 170334181
2-[4-(2-chloropyrimidin-5-yl)triazol-1-yl]-3-methylbutanoic acid (PubChem CID 170334181) has the molecular formula C11H12ClN5O2 and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-[4-(2-chloropyrimidin-5-yl)triazol-1-yl]-3-methylbutanoic acid.
| Compound Name | 2-[4-(2-chloropyrimidin-5-yl)triazol-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 170334181 |
| Molecular Formula | C11H12ClN5O2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-[4-(2-chloropyrimidin-5-yl)triazol-1-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)n1cc(-c2cnc(Cl)nc2)nn1 |
| InChI | InChI=1S/C11H12ClN5O2/c1-6(2)9(10(18)19)17-5-8(15-16-17)7-3-13-11(12)14-4-7/h3-6,9H,1-2H3,(H,18,19) |
| InChIKey | SXOUZINCHDCYIH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |