About 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate
8-[di(nonyl)amino]octyl heptyl hydrogen phosphate (PubChem CID 170336116) has the molecular formula C33H70NO4P
and a molecular weight of 575.90 g/mol. Its IUPAC name is 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate.
Molecular Properties
| Compound Name | 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate |
| PubChem CID | 170336116 |
| Molecular Formula | C33H70NO4P |
| Molecular Weight | 575.90 g/mol |
| Exact Mass | 575.50 |
| IUPAC Name | 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate |
| SMILES | CCCCCCCCCN(CCCCCCCCC)CCCCCCCCOP(=O)(O)OCCCCCCC |
| InChI | InChI=1S/C33H70NO4P/c1-4-7-10-13-15-19-24-29-34(30-25-20-16-14-11-8-5-2)31-26-21-17-18-23-28-33-38-39(35,36)37-32-27-22-12-9-6-3/h4-33H2,1-3H3,(H,35,36) |
| InChIKey | LSNAKWLQBXYBNF-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.90 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate?
The IUPAC name of 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate (CID 170336116) is 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate.
What is the SMILES notation for 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate?
The canonical SMILES for 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate is CCCCCCCCCN(CCCCCCCCC)CCCCCCCCOP(=O)(O)OCCCCCCC.
What is the InChIKey of 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate?
The InChIKey is LSNAKWLQBXYBNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H70NO4P/c1-4-7-10-13-15-19-24-29-34(30-25-20-16-14-11-8-5-2)31-26-21-17-18-23-28-33-38-39(35,36)37-32-27-22-12-9-6-3/h4-33H2,1-3H3,(H,35,36).
What are the key properties of 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate?
8-[di(nonyl)amino]octyl heptyl hydrogen phosphate has a molecular weight of 575.90 g/mol, XLogP of 11.23, 33 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[di(nonyl)amino]octyl heptyl hydrogen phosphate is sourced from PubChem (CID 170336116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).