C23H28FN5O3 — CID 170336776
[(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[4-(hydroxymethyl)cyclohexyl]methanone (PubChem CID 170336776) has the molecular formula C23H28FN5O3 and a molecular weight of 441.51 g/mol. Its IUPAC name is [(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[4-(hydroxymethyl)cyclohexyl]methanone.
| Compound Name | [(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[4-(hydroxymethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 170336776 |
| Molecular Formula | C23H28FN5O3 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [(10S)-4-(3-fluoro-2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]-[4-(hydroxymethyl)cyclohexyl]methanone |
| SMILES | O=C(C1CCC(CO)CC1)N1CCN2c3cc(-c4cccc(F)c4O)nnc3NC[C@H]2C1 |
| InChI | InChI=1S/C23H28FN5O3/c24-18-3-1-2-17(21(18)31)19-10-20-22(27-26-19)25-11-16-12-28(8-9-29(16)20)23(32)15-6-4-14(13-30)5-7-15/h1-3,10,14-16,30-31H,4-9,11-13H2,(H,25,27)/t14?,15?,16-/m0/s1 |
| InChIKey | WERAUPJAVQLHBK-GPANFISMSA-N |
| XLogP | 2.23 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |