C26H19F4N3O5S — CID 170337713
(2R)-N-[[2-[3-(difluoromethoxy)phenyl]-1,6-naphthyridin-7-yl]methyl]-2,6-difluoro-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide (PubChem CID 170337713) has the molecular formula C26H19F4N3O5S and a molecular weight of 561.51 g/mol. Its IUPAC name is (2R)-N-[[2-[3-(difluoromethoxy)phenyl]-1,6-naphthyridin-7-yl]methyl]-2,6-difluoro-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide.
| Compound Name | (2R)-N-[[2-[3-(difluoromethoxy)phenyl]-1,6-naphthyridin-7-yl]methyl]-2,6-difluoro-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
|---|---|
| PubChem CID | 170337713 |
| Molecular Formula | C26H19F4N3O5S |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | (2R)-N-[[2-[3-(difluoromethoxy)phenyl]-1,6-naphthyridin-7-yl]methyl]-2,6-difluoro-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
| SMILES | O=C(NCc1cc2nc(-c3cccc(OC(F)F)c3)ccc2cn1)c1cc(F)c2c(c1)S(=O)(=O)[C@@H](F)COC2 |
| InChI | InChI=1S/C26H19F4N3O5S/c27-20-7-16(8-23-19(20)12-37-13-24(28)39(23,35)36)25(34)32-11-17-9-22-15(10-31-17)4-5-21(33-22)14-2-1-3-18(6-14)38-26(29)30/h1-10,24,26H,11-13H2,(H,32,34)/t24-/m1/s1 |
| InChIKey | JKJSUZOMTADRFW-XMMPIXPASA-N |
| XLogP | 4.57 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |