C30H29ClFN5O5S — CID 170337763
9-chloro-N-[[2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide (PubChem CID 170337763) has the molecular formula C30H29ClFN5O5S and a molecular weight of 626.11 g/mol. Its IUPAC name is 9-chloro-N-[[2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide.
| Compound Name | 9-chloro-N-[[2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide |
|---|---|
| PubChem CID | 170337763 |
| Molecular Formula | C30H29ClFN5O5S |
| Molecular Weight | 626.11 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | 9-chloro-N-[[2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide |
| SMILES | C[C@@H]1CN(c2cccc(-c3ccc4cnc(CNC(=O)c5cc(Cl)c6c(c5)S(=O)(=O)C(F)CCO6)cc4n3)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C30H29ClFN5O5S/c1-17-15-37(16-18(2)42-17)28-5-3-4-23(36-28)24-7-6-19-13-33-21(12-25(19)35-24)14-34-30(38)20-10-22(31)29-26(11-20)43(39,40)27(32)8-9-41-29/h3-7,10-13,17-18,27H,8-9,14-16H2,1-2H3,(H,34,38)/t17-,18+,27? |
| InChIKey | RERJXUIJHJWVTE-BRMUKTHMSA-N |
| XLogP | 4.74 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.11 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |