C26H23IN4O4 — CID 170339448
2-(1-iodo-2,6-dioxopiperidin-3-yl)-N-(2-methyl-1-phenylpropyl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carboxamide (PubChem CID 170339448) has the molecular formula C26H23IN4O4 and a molecular weight of 582.40 g/mol. Its IUPAC name is 2-(1-iodo-2,6-dioxopiperidin-3-yl)-N-(2-methyl-1-phenylpropyl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carboxamide.
| Compound Name | 2-(1-iodo-2,6-dioxopiperidin-3-yl)-N-(2-methyl-1-phenylpropyl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carboxamide |
|---|---|
| PubChem CID | 170339448 |
| Molecular Formula | C26H23IN4O4 |
| Molecular Weight | 582.40 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | 2-(1-iodo-2,6-dioxopiperidin-3-yl)-N-(2-methyl-1-phenylpropyl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene-7-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc2c3c(ccnc13)N(C1CCC(=O)N(I)C1=O)C2=O)c1ccccc1 |
| InChI | InChI=1S/C26H23IN4O4/c1-14(2)22(15-6-4-3-5-7-15)29-24(33)17-9-8-16-21-18(12-13-28-23(17)21)30(25(16)34)19-10-11-20(32)31(27)26(19)35/h3-9,12-14,19,22H,10-11H2,1-2H3,(H,29,33) |
| InChIKey | MXFHWKKOFQENFK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|