About (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid
(5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid (PubChem CID 170340177) has the molecular formula C8H8F3NO5
and a molecular weight of 255.15 g/mol. Its IUPAC name is (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid |
| PubChem CID | 170340177 |
| Molecular Formula | C8H8F3NO5 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1C[C@H](C(F)(F)F)CN(C(=O)O)C1=O |
| InChI | InChI=1S/C8H8F3NO5/c9-8(10,11)3-1-4(6(14)15)5(13)12(2-3)7(16)17/h3-4H,1-2H2,(H,14,15)(H,16,17)/t3-,4?/m0/s1 |
| InChIKey | XPADLOZDOLPLMI-WUCPZUCCSA-N |
| XLogP | 0.78 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid?
The IUPAC name of (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid (CID 170340177) is (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid.
What is the SMILES notation for (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid?
The canonical SMILES for (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid is O=C(O)C1C[C@H](C(F)(F)F)CN(C(=O)O)C1=O.
What is the InChIKey of (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid?
The InChIKey is XPADLOZDOLPLMI-WUCPZUCCSA-N. The full InChI is InChI=1S/C8H8F3NO5/c9-8(10,11)3-1-4(6(14)15)5(13)12(2-3)7(16)17/h3-4H,1-2H2,(H,14,15)(H,16,17)/t3-,4?/m0/s1.
What are the key properties of (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid?
(5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid has a molecular weight of 255.15 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylic acid is sourced from PubChem (CID 170340177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).