About 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one
7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one (PubChem CID 170341263) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one.
Molecular Properties
| Compound Name | 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one |
| PubChem CID | 170341263 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one |
| SMILES | CCCC(C)C1C2CCC2C(C)CC(=O)NC12COC2 |
| InChI | InChI=1S/C17H29NO2/c1-4-5-11(2)16-14-7-6-13(14)12(3)8-15(19)18-17(16)9-20-10-17/h11-14,16H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | BEAFEDDDJMHLEV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one?
The IUPAC name of 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one (CID 170341263) is 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one.
What is the SMILES notation for 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one?
The canonical SMILES for 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one is CCCC(C)C1C2CCC2C(C)CC(=O)NC12COC2.
What is the InChIKey of 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one?
The InChIKey is BEAFEDDDJMHLEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO2/c1-4-5-11(2)16-14-7-6-13(14)12(3)8-15(19)18-17(16)9-20-10-17/h11-14,16H,4-10H2,1-3H3,(H,18,19).
What are the key properties of 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one?
7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one has a molecular weight of 279.42 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-pentan-2-ylspiro[4-azabicyclo[6.2.0]decane-3,3'-oxetane]-5-one is sourced from PubChem (CID 170341263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).