About [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine
[1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine (PubChem CID 170341605) has the molecular formula C12H17F2N3
and a molecular weight of 241.28 g/mol. Its IUPAC name is [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine |
| PubChem CID | 170341605 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine |
| SMILES | C=C(/C=C(\C)Cn1cc(CN)cn1)C(C)(F)F |
| InChI | InChI=1S/C12H17F2N3/c1-9(4-10(2)12(3,13)14)7-17-8-11(5-15)6-16-17/h4,6,8H,2,5,7,15H2,1,3H3/b9-4+ |
| InChIKey | DKCCWCDMZACNEZ-RUDMXATFSA-N |
| XLogP | 2.50 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine?
The IUPAC name of [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine (CID 170341605) is [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine.
What is the SMILES notation for [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine?
The canonical SMILES for [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine is C=C(/C=C(\C)Cn1cc(CN)cn1)C(C)(F)F.
What is the InChIKey of [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine?
The InChIKey is DKCCWCDMZACNEZ-RUDMXATFSA-N. The full InChI is InChI=1S/C12H17F2N3/c1-9(4-10(2)12(3,13)14)7-17-8-11(5-15)6-16-17/h4,6,8H,2,5,7,15H2,1,3H3/b9-4+.
What are the key properties of [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine?
[1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine has a molecular weight of 241.28 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(E)-5,5-difluoro-2-methyl-4-methylidenehex-2-enyl]pyrazol-4-yl]methanamine is sourced from PubChem (CID 170341605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).