C9H11N5 — CID 170342255
5-methyl-3,4,6,7,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene (PubChem CID 170342255) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-methyl-3,4,6,7,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene.
| Compound Name | 5-methyl-3,4,6,7,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene |
|---|---|
| PubChem CID | 170342255 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 5-methyl-3,4,6,7,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene |
| SMILES | Cc1nnc2c3c(cnn12)NCCC3 |
| InChI | InChI=1S/C9H11N5/c1-6-12-13-9-7-3-2-4-10-8(7)5-11-14(6)9/h5,10H,2-4H2,1H3 |
| InChIKey | VTSMDFQJXSLBJK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |