C21H34FN — CID 170342543
(5E,11Z,13E)-N-ethyl-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-amine (PubChem CID 170342543) has the molecular formula C21H34FN and a molecular weight of 319.51 g/mol. Its IUPAC name is (5E,11Z,13E)-N-ethyl-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-amine.
| Compound Name | (5E,11Z,13E)-N-ethyl-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-amine |
|---|---|
| PubChem CID | 170342543 |
| Molecular Formula | C21H34FN |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | (5E,11Z,13E)-N-ethyl-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-amine |
| SMILES | C=C(/C=C\C(F)=C/C)CCC(NCC)C(/C=C\C)=C/CCCC |
| InChI | InChI=1S/C21H34FN/c1-6-10-11-13-19(12-7-2)21(23-9-4)17-15-18(5)14-16-20(22)8-3/h7-8,12-14,16,21,23H,5-6,9-11,15,17H2,1-4H3/b12-7-,16-14-,19-13+,20-8+ |
| InChIKey | CDGXFFMSDKTXKD-RYCWPHOGSA-N |
| XLogP | 6.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|