C12H17F6NO2 — CID 170342557
[(2R,8S)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 170342557) has the molecular formula C12H17F6NO2 and a molecular weight of 321.26 g/mol. Its IUPAC name is [(2R,8S)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(2R,8S)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 170342557 |
| Molecular Formula | C12H17F6NO2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [(2R,8S)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | CC(O[C@H]1CN2CCC[C@@]2(CO)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17F6NO2/c1-9(11(13,14)15,12(16,17)18)21-8-5-10(7-20)3-2-4-19(10)6-8/h8,20H,2-7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | WZXTTYQFGFLKGY-SCZZXKLOSA-N |
| XLogP | 2.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |