C22H24N2O4 — CID 170342569
methyl (1R,12E,17S)-4-acetyloxy-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate (PubChem CID 170342569) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl (1R,12E,17S)-4-acetyloxy-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate.
| Compound Name | methyl (1R,12E,17S)-4-acetyloxy-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 170342569 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl (1R,12E,17S)-4-acetyloxy-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate |
| SMILES | C/C=C1/CN2CC[C@]34C(=C(C(=O)OC)C1C[C@H]23)Nc1ccc(OC(C)=O)cc14 |
| InChI | InChI=1S/C22H24N2O4/c1-4-13-11-24-8-7-22-16-9-14(28-12(2)25)5-6-17(16)23-20(22)19(21(26)27-3)15(13)10-18(22)24/h4-6,9,15,18,23H,7-8,10-11H2,1-3H3/b13-4-/t15?,18-,22+/m0/s1 |
| InChIKey | WSEWOMRNCXRCGR-LARFJUHYSA-N |
| XLogP | 2.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|