About 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine
4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine (PubChem CID 170342672) has the molecular formula C8H15F2N2O2S-
and a molecular weight of 241.28 g/mol. Its IUPAC name is 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine.
Molecular Properties
| Compound Name | 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine |
| PubChem CID | 170342672 |
| Molecular Formula | C8H15F2N2O2S- |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine |
| SMILES | CC(F)(F)C(NS(=O)[O-])C1CCNCC1 |
| InChI | InChI=1S/C8H16F2N2O2S/c1-8(9,10)7(12-15(13)14)6-2-4-11-5-3-6/h6-7,11-12H,2-5H2,1H3,(H,13,14)/p-1 |
| InChIKey | UKKNPIMZWXCNTQ-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine?
The IUPAC name of 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine (CID 170342672) is 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine.
What is the SMILES notation for 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine?
The canonical SMILES for 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine is CC(F)(F)C(NS(=O)[O-])C1CCNCC1.
What is the InChIKey of 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine?
The InChIKey is UKKNPIMZWXCNTQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16F2N2O2S/c1-8(9,10)7(12-15(13)14)6-2-4-11-5-3-6/h6-7,11-12H,2-5H2,1H3,(H,13,14)/p-1.
What are the key properties of 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine?
4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine has a molecular weight of 241.28 g/mol, XLogP of 0.39, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-difluoro-1-(sulfinatoamino)propyl]piperidine is sourced from PubChem (CID 170342672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).