About 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide
2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide (PubChem CID 170343469) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide.
Molecular Properties
| Compound Name | 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide |
| PubChem CID | 170343469 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide |
| SMILES | C=C/C=C(\C=N\C)CCC(C)NC(=O)C(=C)CC |
| InChI | InChI=1S/C15H24N2O/c1-6-8-14(11-16-5)10-9-13(4)17-15(18)12(3)7-2/h6,8,11,13H,1,3,7,9-10H2,2,4-5H3,(H,17,18)/b14-8-,16-11+ |
| InChIKey | AGVXRBVPNYVXKJ-MIGJSOBLSA-N |
| XLogP | 3.05 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide?
The IUPAC name of 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide (CID 170343469) is 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide.
What is the SMILES notation for 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide?
The canonical SMILES for 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide is C=C/C=C(\C=N\C)CCC(C)NC(=O)C(=C)CC.
What is the InChIKey of 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide?
The InChIKey is AGVXRBVPNYVXKJ-MIGJSOBLSA-N. The full InChI is InChI=1S/C15H24N2O/c1-6-8-14(11-16-5)10-9-13(4)17-15(18)12(3)7-2/h6,8,11,13H,1,3,7,9-10H2,2,4-5H3,(H,17,18)/b14-8-,16-11+.
What are the key properties of 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide?
2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide has a molecular weight of 248.37 g/mol, XLogP of 3.05, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-N-[(5Z)-5-(methyliminomethyl)octa-5,7-dien-2-yl]butanamide is sourced from PubChem (CID 170343469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).