C23H20N4O3 — CID 170343884
2-[[(1R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)ethyl]amino]acetonitrile (PubChem CID 170343884) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[[(1R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)ethyl]amino]acetonitrile.
| Compound Name | 2-[[(1R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)ethyl]amino]acetonitrile |
|---|---|
| PubChem CID | 170343884 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[[(1R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2-(1,3-dioxoisoindol-2-yl)ethyl]amino]acetonitrile |
| SMILES | Cc1noc(C)c1-c1ccc([C@H](CN2C(=O)c3ccccc3C2=O)NCC#N)cc1 |
| InChI | InChI=1S/C23H20N4O3/c1-14-21(15(2)30-26-14)17-9-7-16(8-10-17)20(25-12-11-24)13-27-22(28)18-5-3-4-6-19(18)23(27)29/h3-10,20,25H,12-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | GMMMDHXEDRIPJK-FQEVSTJZSA-N |
| XLogP | 3.41 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|