C50H56Cl4N6O8 — CID 170343888
N,N'-bis[2-[2-[2-[5-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-3-oxo-1H-isoindol-2-yl]ethoxy]ethoxy]ethyl]oxamide (PubChem CID 170343888) has the molecular formula C50H56Cl4N6O8 and a molecular weight of 1010.84 g/mol. Its IUPAC name is N,N'-bis[2-[2-[2-[5-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-3-oxo-1H-isoindol-2-yl]ethoxy]ethoxy]ethyl]oxamide.
| Compound Name | N,N'-bis[2-[2-[2-[5-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-3-oxo-1H-isoindol-2-yl]ethoxy]ethoxy]ethyl]oxamide |
|---|---|
| PubChem CID | 170343888 |
| Molecular Formula | C50H56Cl4N6O8 |
| Molecular Weight | 1010.84 g/mol |
| Exact Mass | 1008.29 |
| IUPAC Name | N,N'-bis[2-[2-[2-[5-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-3-oxo-1H-isoindol-2-yl]ethoxy]ethoxy]ethyl]oxamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccc3c(c2)C(=O)N(CCOCCOCCNC(=O)C(=O)NCCOCCOCCN2Cc4ccc(C5CN(C)Cc6c(Cl)cc(Cl)cc65)cc4C2=O)C3)C1 |
| InChI | InChI=1S/C50H56Cl4N6O8/c1-57-27-41(39-21-35(51)23-45(53)43(39)29-57)31-3-5-33-25-59(49(63)37(33)19-31)9-13-67-17-15-65-11-7-55-47(61)48(62)56-8-12-66-16-18-68-14-10-60-26-34-6-4-32(20-38(34)50(60)64)42-28-58(2)30-44-40(42)22-36(52)24-46(44)54/h3-6,19-24,41-42H,7-18,25-30H2,1-2H3,(H,55,61)(H,56,62) |
| InChIKey | UWAQPTXIGSNVDK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.84 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|