C12H12F3N3O2 — CID 170345747
methyl N-[[2-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate (PubChem CID 170345747) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is methyl N-[[2-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate.
| Compound Name | methyl N-[[2-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate |
|---|---|
| PubChem CID | 170345747 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl N-[[2-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate |
| SMILES | COC(=O)NNC1=NC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C12H12F3N3O2/c1-20-12(19)18-17-10-3-2-9(16-10)6-4-7(13)11(15)8(14)5-6/h4-5,9H,2-3H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | OGYTYKGRPIEHHK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|